C24H23F2N3O — CID 30290633
[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-(6-methyl-3-pyridinyl)methanone (PubChem CID 30290633) has the molecular formula C24H23F2N3O and a molecular weight of 407.46 g/mol. Its IUPAC name is [4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-(6-methyl-3-pyridinyl)methanone.
| Compound Name | [4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-(6-methyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 30290633 |
| Molecular Formula | C24H23F2N3O |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | [4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-(6-methyl-3-pyridinyl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)cn1 |
| InChI | InChI=1S/C24H23F2N3O/c1-17-2-3-20(16-27-17)24(30)29-14-12-28(13-15-29)23(18-4-8-21(25)9-5-18)19-6-10-22(26)11-7-19/h2-11,16,23H,12-15H2,1H3 |
| InChIKey | DJFCVAYOJDIBSB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |