C25H26F2N4O — CID 60551277
[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-[2-(dimethylamino)-3-pyridinyl]methanone (PubChem CID 60551277) has the molecular formula C25H26F2N4O and a molecular weight of 436.51 g/mol. Its IUPAC name is [4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-[2-(dimethylamino)-3-pyridinyl]methanone.
| Compound Name | [4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-[2-(dimethylamino)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 60551277 |
| Molecular Formula | C25H26F2N4O |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | [4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-[2-(dimethylamino)-3-pyridinyl]methanone |
| SMILES | CN(C)c1ncccc1C(=O)N1CCN(C(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C25H26F2N4O/c1-29(2)24-22(4-3-13-28-24)25(32)31-16-14-30(15-17-31)23(18-5-9-20(26)10-6-18)19-7-11-21(27)12-8-19/h3-13,23H,14-17H2,1-2H3 |
| InChIKey | FMOGRFNGRVEQFB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |