C25H22F2N4O — CID 37314320
[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-(1H-indazol-7-yl)methanone (PubChem CID 37314320) has the molecular formula C25H22F2N4O and a molecular weight of 432.47 g/mol. Its IUPAC name is [4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-(1H-indazol-7-yl)methanone.
| Compound Name | [4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-(1H-indazol-7-yl)methanone |
|---|---|
| PubChem CID | 37314320 |
| Molecular Formula | C25H22F2N4O |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | [4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-(1H-indazol-7-yl)methanone |
| SMILES | O=C(c1cccc2cn[nH]c12)N1CCN(C(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C25H22F2N4O/c26-20-8-4-17(5-9-20)24(18-6-10-21(27)11-7-18)30-12-14-31(15-13-30)25(32)22-3-1-2-19-16-28-29-23(19)22/h1-11,16,24H,12-15H2,(H,28,29) |
| InChIKey | UAYJECAXLFFVGO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |