C21H22N4O2 — CID 32773251
(4-ethylphenyl)-[4-(1H-indazole-7-carbonyl)piperazin-1-yl]methanone (PubChem CID 32773251) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is (4-ethylphenyl)-[4-(1H-indazole-7-carbonyl)piperazin-1-yl]methanone.
| Compound Name | (4-ethylphenyl)-[4-(1H-indazole-7-carbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 32773251 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (4-ethylphenyl)-[4-(1H-indazole-7-carbonyl)piperazin-1-yl]methanone |
| SMILES | CCc1ccc(C(=O)N2CCN(C(=O)c3cccc4cn[nH]c34)CC2)cc1 |
| InChI | InChI=1S/C21H22N4O2/c1-2-15-6-8-16(9-7-15)20(26)24-10-12-25(13-11-24)21(27)18-5-3-4-17-14-22-23-19(17)18/h3-9,14H,2,10-13H2,1H3,(H,22,23) |
| InChIKey | YSBGGYKBYLLUIV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |