C22H20F2N4O2 — CID 8929352
3-[4-[bis(4-fluorophenyl)methyl]piperazine-1-carbonyl]-1H-pyridazin-6-one (PubChem CID 8929352) has the molecular formula C22H20F2N4O2 and a molecular weight of 410.42 g/mol. Its IUPAC name is 3-[4-[bis(4-fluorophenyl)methyl]piperazine-1-carbonyl]-1H-pyridazin-6-one.
| Compound Name | 3-[4-[bis(4-fluorophenyl)methyl]piperazine-1-carbonyl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 8929352 |
| Molecular Formula | C22H20F2N4O2 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 3-[4-[bis(4-fluorophenyl)methyl]piperazine-1-carbonyl]-1H-pyridazin-6-one |
| SMILES | O=C(c1ccc(=O)[nH]n1)N1CCN(C(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H20F2N4O2/c23-17-5-1-15(2-6-17)21(16-3-7-18(24)8-4-16)27-11-13-28(14-12-27)22(30)19-9-10-20(29)26-25-19/h1-10,21H,11-14H2,(H,26,29) |
| InChIKey | GDDNCPVEJVTEQJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |