C30H30N2O3S — CID 30303921
2-[N-(benzenesulfonyl)-2-ethylanilino]-N-[(S)-(2-methylphenyl)-phenylmethyl]acetamide (PubChem CID 30303921) has the molecular formula C30H30N2O3S and a molecular weight of 498.65 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2-ethylanilino]-N-[(S)-(2-methylphenyl)-phenylmethyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2-ethylanilino]-N-[(S)-(2-methylphenyl)-phenylmethyl]acetamide |
|---|---|
| PubChem CID | 30303921 |
| Molecular Formula | C30H30N2O3S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2-ethylanilino]-N-[(S)-(2-methylphenyl)-phenylmethyl]acetamide |
| SMILES | CCc1ccccc1N(CC(=O)N[C@@H](c1ccccc1)c1ccccc1C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H30N2O3S/c1-3-24-15-11-13-21-28(24)32(36(34,35)26-18-8-5-9-19-26)22-29(33)31-30(25-16-6-4-7-17-25)27-20-12-10-14-23(27)2/h4-21,30H,3,22H2,1-2H3,(H,31,33)/t30-/m0/s1 |
| InChIKey | SDRIGUJOYRDBOU-PMERELPUSA-N |
| XLogP | 5.66 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |