C24H25ClN2O4S — CID 30306359
2-(2-chloro-N-(4-methylphenyl)sulfonylanilino)-N-[(3-ethoxyphenyl)methyl]acetamide (PubChem CID 30306359) has the molecular formula C24H25ClN2O4S and a molecular weight of 472.99 g/mol. Its IUPAC name is 2-(2-chloro-N-(4-methylphenyl)sulfonylanilino)-N-[(3-ethoxyphenyl)methyl]acetamide.
| Compound Name | 2-(2-chloro-N-(4-methylphenyl)sulfonylanilino)-N-[(3-ethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 30306359 |
| Molecular Formula | C24H25ClN2O4S |
| Molecular Weight | 472.99 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 2-(2-chloro-N-(4-methylphenyl)sulfonylanilino)-N-[(3-ethoxyphenyl)methyl]acetamide |
| SMILES | CCOc1cccc(CNC(=O)CN(c2ccccc2Cl)S(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C24H25ClN2O4S/c1-3-31-20-8-6-7-19(15-20)16-26-24(28)17-27(23-10-5-4-9-22(23)25)32(29,30)21-13-11-18(2)12-14-21/h4-15H,3,16-17H2,1-2H3,(H,26,28) |
| InChIKey | CHZORDDWZMFYAV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.99 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |