C26H27ClN2O6S — CID 90121238
2-(3-chloro-2-methoxy-N-(4-methylphenyl)sulfonylanilino)-N-[[3-[(2R)-1-oxopropan-2-yl]oxyphenyl]methyl]acetamide (PubChem CID 90121238) has the molecular formula C26H27ClN2O6S and a molecular weight of 531.03 g/mol. Its IUPAC name is 2-(3-chloro-2-methoxy-N-(4-methylphenyl)sulfonylanilino)-N-[[3-[(2R)-1-oxopropan-2-yl]oxyphenyl]methyl]acetamide.
| Compound Name | 2-(3-chloro-2-methoxy-N-(4-methylphenyl)sulfonylanilino)-N-[[3-[(2R)-1-oxopropan-2-yl]oxyphenyl]methyl]acetamide |
|---|---|
| PubChem CID | 90121238 |
| Molecular Formula | C26H27ClN2O6S |
| Molecular Weight | 531.03 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | 2-(3-chloro-2-methoxy-N-(4-methylphenyl)sulfonylanilino)-N-[[3-[(2R)-1-oxopropan-2-yl]oxyphenyl]methyl]acetamide |
| SMILES | COc1c(Cl)cccc1N(CC(=O)NCc1cccc(O[C@H](C)C=O)c1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H27ClN2O6S/c1-18-10-12-22(13-11-18)36(32,33)29(24-9-5-8-23(27)26(24)34-3)16-25(31)28-15-20-6-4-7-21(14-20)35-19(2)17-30/h4-14,17,19H,15-16H2,1-3H3,(H,28,31)/t19-/m1/s1 |
| InChIKey | ALPZXMJJGHFPFE-LJQANCHMSA-N |
| XLogP | 4.13 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.03 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|