C24H25BrN2O4S — CID 30306538
2-(3-bromo-N-(4-methylphenyl)sulfonylanilino)-N-[(1R)-1-(4-methoxyphenyl)ethyl]acetamide (PubChem CID 30306538) has the molecular formula C24H25BrN2O4S and a molecular weight of 517.45 g/mol. Its IUPAC name is 2-(3-bromo-N-(4-methylphenyl)sulfonylanilino)-N-[(1R)-1-(4-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(3-bromo-N-(4-methylphenyl)sulfonylanilino)-N-[(1R)-1-(4-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 30306538 |
| Molecular Formula | C24H25BrN2O4S |
| Molecular Weight | 517.45 g/mol |
| Exact Mass | 516.07 |
| IUPAC Name | 2-(3-bromo-N-(4-methylphenyl)sulfonylanilino)-N-[(1R)-1-(4-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc([C@@H](C)NC(=O)CN(c2cccc(Br)c2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H25BrN2O4S/c1-17-7-13-23(14-8-17)32(29,30)27(21-6-4-5-20(25)15-21)16-24(28)26-18(2)19-9-11-22(31-3)12-10-19/h4-15,18H,16H2,1-3H3,(H,26,28)/t18-/m1/s1 |
| InChIKey | JGFDJGHOGFEVJU-GOSISDBHSA-N |
| XLogP | 4.84 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |