propan-2-yl 2,3-bis(tert-butylamino)propanoate

C14H30N2O2 — CID 3030822

IUPACpropan-2-yl 2,3-bis(tert-butylamino)propanoate
SMILESCC(C)OC(=O)C(CNC(C)(C)C)NC(C)(C)C
InChIInChI=1S/C14H30N2O2/c1-10(2)18-12(17)11(16-14(6,7)8)9-15-13(3,4)5/h10-11,15-16H,9H2,1-8H3
InChIKeyFTTBUHJHQYXJLQ-UHFFFAOYSA-N
MW258.41 g/mol
LogP2.08
Rot. Bonds5

About propan-2-yl 2,3-bis(tert-butylamino)propanoate

propan-2-yl 2,3-bis(tert-butylamino)propanoate (PubChem CID 3030822) has the molecular formula C14H30N2O2 and a molecular weight of 258.41 g/mol. Its IUPAC name is propan-2-yl 2,3-bis(tert-butylamino)propanoate.

Molecular Properties

Compound Namepropan-2-yl 2,3-bis(tert-butylamino)propanoate
PubChem CID3030822
Molecular FormulaC14H30N2O2
Molecular Weight258.41 g/mol
Exact Mass258.23
IUPAC Namepropan-2-yl 2,3-bis(tert-butylamino)propanoate
SMILESCC(C)OC(=O)C(CNC(C)(C)C)NC(C)(C)C
InChIInChI=1S/C14H30N2O2/c1-10(2)18-12(17)11(16-14(6,7)8)9-15-13(3,4)5/h10-11,15-16H,9H2,1-8H3
InChIKeyFTTBUHJHQYXJLQ-UHFFFAOYSA-N
XLogP2.08
TPSA50.36 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.41
LogP ≤ 52.08
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze propan-2-yl 2,3-bis(tert-butylamino)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of propan-2-yl 2,3-bis(tert-butylamino)propanoate?
The IUPAC name of propan-2-yl 2,3-bis(tert-butylamino)propanoate (CID 3030822) is propan-2-yl 2,3-bis(tert-butylamino)propanoate.
What is the SMILES notation for propan-2-yl 2,3-bis(tert-butylamino)propanoate?
The canonical SMILES for propan-2-yl 2,3-bis(tert-butylamino)propanoate is CC(C)OC(=O)C(CNC(C)(C)C)NC(C)(C)C.
What is the InChIKey of propan-2-yl 2,3-bis(tert-butylamino)propanoate?
The InChIKey is FTTBUHJHQYXJLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30N2O2/c1-10(2)18-12(17)11(16-14(6,7)8)9-15-13(3,4)5/h10-11,15-16H,9H2,1-8H3.
What are the key properties of propan-2-yl 2,3-bis(tert-butylamino)propanoate?
propan-2-yl 2,3-bis(tert-butylamino)propanoate has a molecular weight of 258.41 g/mol, XLogP of 2.08, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2,3-bis(tert-butylamino)propanoate is sourced from PubChem (CID 3030822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).