C14H30N2O2 — CID 3030822
propan-2-yl 2,3-bis(tert-butylamino)propanoate (PubChem CID 3030822) has the molecular formula C14H30N2O2 and a molecular weight of 258.41 g/mol. Its IUPAC name is propan-2-yl 2,3-bis(tert-butylamino)propanoate.
| Compound Name | propan-2-yl 2,3-bis(tert-butylamino)propanoate |
|---|---|
| PubChem CID | 3030822 |
| Molecular Formula | C14H30N2O2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | propan-2-yl 2,3-bis(tert-butylamino)propanoate |
| SMILES | CC(C)OC(=O)C(CNC(C)(C)C)NC(C)(C)C |
| InChI | InChI=1S/C14H30N2O2/c1-10(2)18-12(17)11(16-14(6,7)8)9-15-13(3,4)5/h10-11,15-16H,9H2,1-8H3 |
| InChIKey | FTTBUHJHQYXJLQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |