C18H35NO4 — CID 59184882
propan-2-yl (2S)-8-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoate (PubChem CID 59184882) has the molecular formula C18H35NO4 and a molecular weight of 329.48 g/mol. Its IUPAC name is propan-2-yl (2S)-8-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoate.
| Compound Name | propan-2-yl (2S)-8-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoate |
|---|---|
| PubChem CID | 59184882 |
| Molecular Formula | C18H35NO4 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.26 |
| IUPAC Name | propan-2-yl (2S)-8-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoate |
| SMILES | CC(C)CCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)OC(C)C |
| InChI | InChI=1S/C18H35NO4/c1-13(2)11-9-8-10-12-15(16(20)22-14(3)4)19-17(21)23-18(5,6)7/h13-15H,8-12H2,1-7H3,(H,19,21)/t15-/m0/s1 |
| InChIKey | SBNQJPAJLSZPFG-HNNXBMFYSA-N |
| XLogP | 4.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|