About butan-2-ylcarbamic acid
butan-2-ylcarbamic acid (PubChem CID 3030880) has the molecular formula C5H11NO2
and a molecular weight of 117.15 g/mol. Its IUPAC name is butan-2-ylcarbamic acid.
Molecular Properties
| Compound Name | butan-2-ylcarbamic acid |
| PubChem CID | 3030880 |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.08 |
| IUPAC Name | butan-2-ylcarbamic acid |
| SMILES | CCC(C)NC(=O)O |
| InChI | InChI=1S/C5H11NO2/c1-3-4(2)6-5(7)8/h4,6H,3H2,1-2H3,(H,7,8) |
| InChIKey | QCIGLPLDNRDLQQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butan-2-ylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-ylcarbamic acid?
The IUPAC name of butan-2-ylcarbamic acid (CID 3030880) is butan-2-ylcarbamic acid.
What is the SMILES notation for butan-2-ylcarbamic acid?
The canonical SMILES for butan-2-ylcarbamic acid is CCC(C)NC(=O)O.
What is the InChIKey of butan-2-ylcarbamic acid?
The InChIKey is QCIGLPLDNRDLQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2/c1-3-4(2)6-5(7)8/h4,6H,3H2,1-2H3,(H,7,8).
What are the key properties of butan-2-ylcarbamic acid?
butan-2-ylcarbamic acid has a molecular weight of 117.15 g/mol, XLogP of 1.05, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-ylcarbamic acid is sourced from PubChem (CID 3030880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).