About 2,6-dichlorobenzonitrile
2,6-dichlorobenzonitrile (PubChem CID 3031) has the molecular formula C7H3Cl2N
and a molecular weight of 172.01 g/mol. Its IUPAC name is 2,6-dichlorobenzonitrile.
Molecular Properties
| Compound Name | 2,6-dichlorobenzonitrile |
| PubChem CID | 3031 |
| Molecular Formula | C7H3Cl2N |
| Molecular Weight | 172.01 g/mol |
| Exact Mass | 170.96 |
| IUPAC Name | 2,6-dichlorobenzonitrile |
| SMILES | N#Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C7H3Cl2N/c8-6-2-1-3-7(9)5(6)4-10/h1-3H |
| InChIKey | YOYAIZYFCNQIRF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.01 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,6-dichlorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dichlorobenzonitrile?
The IUPAC name of 2,6-dichlorobenzonitrile (CID 3031) is 2,6-dichlorobenzonitrile.
What is the SMILES notation for 2,6-dichlorobenzonitrile?
The canonical SMILES for 2,6-dichlorobenzonitrile is N#Cc1c(Cl)cccc1Cl.
What is the InChIKey of 2,6-dichlorobenzonitrile?
The InChIKey is YOYAIZYFCNQIRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3Cl2N/c8-6-2-1-3-7(9)5(6)4-10/h1-3H.
What are the key properties of 2,6-dichlorobenzonitrile?
2,6-dichlorobenzonitrile has a molecular weight of 172.01 g/mol, XLogP of 2.87, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichlorobenzonitrile is sourced from PubChem (CID 3031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).