C18H25N5O2 — CID 30313762
methyl N-methyl-N-[4-methyl-1-[1-(2-methylphenyl)tetrazol-5-yl]cyclohexyl]carbamate (PubChem CID 30313762) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is methyl N-methyl-N-[4-methyl-1-[1-(2-methylphenyl)tetrazol-5-yl]cyclohexyl]carbamate.
| Compound Name | methyl N-methyl-N-[4-methyl-1-[1-(2-methylphenyl)tetrazol-5-yl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 30313762 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | methyl N-methyl-N-[4-methyl-1-[1-(2-methylphenyl)tetrazol-5-yl]cyclohexyl]carbamate |
| SMILES | COC(=O)N(C)C1(c2nnnn2-c2ccccc2C)CCC(C)CC1 |
| InChI | InChI=1S/C18H25N5O2/c1-13-9-11-18(12-10-13,22(3)17(24)25-4)16-19-20-21-23(16)15-8-6-5-7-14(15)2/h5-8,13H,9-12H2,1-4H3 |
| InChIKey | OEIDALUWUCHFJK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |