C19H25N5O4 — CID 30313787
methyl 2-[5-[1-[methoxycarbonyl(methyl)amino]-4-methylcyclohexyl]tetrazol-1-yl]benzoate (PubChem CID 30313787) has the molecular formula C19H25N5O4 and a molecular weight of 387.44 g/mol. Its IUPAC name is methyl 2-[5-[1-[methoxycarbonyl(methyl)amino]-4-methylcyclohexyl]tetrazol-1-yl]benzoate.
| Compound Name | methyl 2-[5-[1-[methoxycarbonyl(methyl)amino]-4-methylcyclohexyl]tetrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 30313787 |
| Molecular Formula | C19H25N5O4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | methyl 2-[5-[1-[methoxycarbonyl(methyl)amino]-4-methylcyclohexyl]tetrazol-1-yl]benzoate |
| SMILES | COC(=O)c1ccccc1-n1nnnc1C1(N(C)C(=O)OC)CCC(C)CC1 |
| InChI | InChI=1S/C19H25N5O4/c1-13-9-11-19(12-10-13,23(2)18(26)28-4)17-20-21-22-24(17)15-8-6-5-7-14(15)16(25)27-3/h5-8,13H,9-12H2,1-4H3 |
| InChIKey | ZTODAKLHKSLJDN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 99.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |