C20H27N5O4 — CID 30312689
methyl 2-[5-[1-[(2-ethoxy-2-oxoethyl)amino]-4-methylcyclohexyl]tetrazol-1-yl]benzoate (PubChem CID 30312689) has the molecular formula C20H27N5O4 and a molecular weight of 401.47 g/mol. Its IUPAC name is methyl 2-[5-[1-[(2-ethoxy-2-oxoethyl)amino]-4-methylcyclohexyl]tetrazol-1-yl]benzoate.
| Compound Name | methyl 2-[5-[1-[(2-ethoxy-2-oxoethyl)amino]-4-methylcyclohexyl]tetrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 30312689 |
| Molecular Formula | C20H27N5O4 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | methyl 2-[5-[1-[(2-ethoxy-2-oxoethyl)amino]-4-methylcyclohexyl]tetrazol-1-yl]benzoate |
| SMILES | CCOC(=O)CNC1(c2nnnn2-c2ccccc2C(=O)OC)CCC(C)CC1 |
| InChI | InChI=1S/C20H27N5O4/c1-4-29-17(26)13-21-20(11-9-14(2)10-12-20)19-22-23-24-25(19)16-8-6-5-7-15(16)18(27)28-3/h5-8,14,21H,4,9-13H2,1-3H3 |
| InChIKey | ZYVCIMTZNKTLHA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |