C17H22ClN5O2 — CID 53297705
ethyl 2-[[1-[1-(3-chlorophenyl)tetrazol-5-yl]cyclohexyl]amino]acetate (PubChem CID 53297705) has the molecular formula C17H22ClN5O2 and a molecular weight of 363.85 g/mol. Its IUPAC name is ethyl 2-[[1-[1-(3-chlorophenyl)tetrazol-5-yl]cyclohexyl]amino]acetate.
| Compound Name | ethyl 2-[[1-[1-(3-chlorophenyl)tetrazol-5-yl]cyclohexyl]amino]acetate |
|---|---|
| PubChem CID | 53297705 |
| Molecular Formula | C17H22ClN5O2 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | ethyl 2-[[1-[1-(3-chlorophenyl)tetrazol-5-yl]cyclohexyl]amino]acetate |
| SMILES | CCOC(=O)CNC1(c2nnnn2-c2cccc(Cl)c2)CCCCC1 |
| InChI | InChI=1S/C17H22ClN5O2/c1-2-25-15(24)12-19-17(9-4-3-5-10-17)16-20-21-22-23(16)14-8-6-7-13(18)11-14/h6-8,11,19H,2-5,9-10,12H2,1H3 |
| InChIKey | JZBVPUTVRLORKM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |