C23H27N5O3 — CID 30309882
ethyl 3-[5-[1-(4-methoxyanilino)cyclohexyl]tetrazol-1-yl]benzoate (PubChem CID 30309882) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is ethyl 3-[5-[1-(4-methoxyanilino)cyclohexyl]tetrazol-1-yl]benzoate.
| Compound Name | ethyl 3-[5-[1-(4-methoxyanilino)cyclohexyl]tetrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 30309882 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | ethyl 3-[5-[1-(4-methoxyanilino)cyclohexyl]tetrazol-1-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(-n2nnnc2C2(Nc3ccc(OC)cc3)CCCCC2)c1 |
| InChI | InChI=1S/C23H27N5O3/c1-3-31-21(29)17-8-7-9-19(16-17)28-22(25-26-27-28)23(14-5-4-6-15-23)24-18-10-12-20(30-2)13-11-18/h7-13,16,24H,3-6,14-15H2,1-2H3 |
| InChIKey | CFRGGMYHQJSTIJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|