C24H29N5O2 — CID 30312319
ethyl 3-[5-[4-methyl-1-(4-methylanilino)cyclohexyl]tetrazol-1-yl]benzoate (PubChem CID 30312319) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is ethyl 3-[5-[4-methyl-1-(4-methylanilino)cyclohexyl]tetrazol-1-yl]benzoate.
| Compound Name | ethyl 3-[5-[4-methyl-1-(4-methylanilino)cyclohexyl]tetrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 30312319 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | ethyl 3-[5-[4-methyl-1-(4-methylanilino)cyclohexyl]tetrazol-1-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(-n2nnnc2C2(Nc3ccc(C)cc3)CCC(C)CC2)c1 |
| InChI | InChI=1S/C24H29N5O2/c1-4-31-22(30)19-6-5-7-21(16-19)29-23(26-27-28-29)24(14-12-18(3)13-15-24)25-20-10-8-17(2)9-11-20/h5-11,16,18,25H,4,12-15H2,1-3H3 |
| InChIKey | NVCUYKGUBAMPID-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |