C21H29N5O3 — CID 30314325
ethyl 3-[5-(4-methyl-1-morpholin-4-ylcyclohexyl)tetrazol-1-yl]benzoate (PubChem CID 30314325) has the molecular formula C21H29N5O3 and a molecular weight of 399.50 g/mol. Its IUPAC name is ethyl 3-[5-(4-methyl-1-morpholin-4-ylcyclohexyl)tetrazol-1-yl]benzoate.
| Compound Name | ethyl 3-[5-(4-methyl-1-morpholin-4-ylcyclohexyl)tetrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 30314325 |
| Molecular Formula | C21H29N5O3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | ethyl 3-[5-(4-methyl-1-morpholin-4-ylcyclohexyl)tetrazol-1-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(-n2nnnc2C2(N3CCOCC3)CCC(C)CC2)c1 |
| InChI | InChI=1S/C21H29N5O3/c1-3-29-19(27)17-5-4-6-18(15-17)26-20(22-23-24-26)21(9-7-16(2)8-10-21)25-11-13-28-14-12-25/h4-6,15-16H,3,7-14H2,1-2H3 |
| InChIKey | IBXLGMNSRLYSHP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |