C19H27N5O3 — CID 30312714
ethyl 2-[[1-[1-(3-methoxyphenyl)tetrazol-5-yl]-4-methylcyclohexyl]amino]acetate (PubChem CID 30312714) has the molecular formula C19H27N5O3 and a molecular weight of 373.46 g/mol. Its IUPAC name is ethyl 2-[[1-[1-(3-methoxyphenyl)tetrazol-5-yl]-4-methylcyclohexyl]amino]acetate.
| Compound Name | ethyl 2-[[1-[1-(3-methoxyphenyl)tetrazol-5-yl]-4-methylcyclohexyl]amino]acetate |
|---|---|
| PubChem CID | 30312714 |
| Molecular Formula | C19H27N5O3 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | ethyl 2-[[1-[1-(3-methoxyphenyl)tetrazol-5-yl]-4-methylcyclohexyl]amino]acetate |
| SMILES | CCOC(=O)CNC1(c2nnnn2-c2cccc(OC)c2)CCC(C)CC1 |
| InChI | InChI=1S/C19H27N5O3/c1-4-27-17(25)13-20-19(10-8-14(2)9-11-19)18-21-22-23-24(18)15-6-5-7-16(12-15)26-3/h5-7,12,14,20H,4,8-11,13H2,1-3H3 |
| InChIKey | ASPSYFQMMZWRHD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |