C25H29N5O3 — CID 30313546
ethyl 3-[5-[1-[benzoyl(methyl)amino]-4-methylcyclohexyl]tetrazol-1-yl]benzoate (PubChem CID 30313546) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is ethyl 3-[5-[1-[benzoyl(methyl)amino]-4-methylcyclohexyl]tetrazol-1-yl]benzoate.
| Compound Name | ethyl 3-[5-[1-[benzoyl(methyl)amino]-4-methylcyclohexyl]tetrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 30313546 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | ethyl 3-[5-[1-[benzoyl(methyl)amino]-4-methylcyclohexyl]tetrazol-1-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(-n2nnnc2C2(N(C)C(=O)c3ccccc3)CCC(C)CC2)c1 |
| InChI | InChI=1S/C25H29N5O3/c1-4-33-23(32)20-11-8-12-21(17-20)30-24(26-27-28-30)25(15-13-18(2)14-16-25)29(3)22(31)19-9-6-5-7-10-19/h5-12,17-18H,4,13-16H2,1-3H3 |
| InChIKey | QQHGRMHZYINOEY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |