C20H27N5O4 — CID 30311323
ethyl 3-[5-[1-[ethoxycarbonyl(methyl)amino]cyclohexyl]tetrazol-1-yl]benzoate (PubChem CID 30311323) has the molecular formula C20H27N5O4 and a molecular weight of 401.47 g/mol. Its IUPAC name is ethyl 3-[5-[1-[ethoxycarbonyl(methyl)amino]cyclohexyl]tetrazol-1-yl]benzoate.
| Compound Name | ethyl 3-[5-[1-[ethoxycarbonyl(methyl)amino]cyclohexyl]tetrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 30311323 |
| Molecular Formula | C20H27N5O4 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | ethyl 3-[5-[1-[ethoxycarbonyl(methyl)amino]cyclohexyl]tetrazol-1-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(-n2nnnc2C2(N(C)C(=O)OCC)CCCCC2)c1 |
| InChI | InChI=1S/C20H27N5O4/c1-4-28-17(26)15-10-9-11-16(14-15)25-18(21-22-23-25)20(12-7-6-8-13-20)24(3)19(27)29-5-2/h9-11,14H,4-8,12-13H2,1-3H3 |
| InChIKey | XLIZVWHCHDUOEL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 99.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |