C22H26BrN5 — CID 3560575
3-bromo-4-methyl-N-[4-methyl-1-[1-(4-methylphenyl)tetrazol-5-yl]cyclohexyl]aniline (PubChem CID 3560575) has the molecular formula C22H26BrN5 and a molecular weight of 440.39 g/mol. Its IUPAC name is 3-bromo-4-methyl-N-[4-methyl-1-[1-(4-methylphenyl)tetrazol-5-yl]cyclohexyl]aniline.
| Compound Name | 3-bromo-4-methyl-N-[4-methyl-1-[1-(4-methylphenyl)tetrazol-5-yl]cyclohexyl]aniline |
|---|---|
| PubChem CID | 3560575 |
| Molecular Formula | C22H26BrN5 |
| Molecular Weight | 440.39 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 3-bromo-4-methyl-N-[4-methyl-1-[1-(4-methylphenyl)tetrazol-5-yl]cyclohexyl]aniline |
| SMILES | Cc1ccc(-n2nnnc2C2(Nc3ccc(C)c(Br)c3)CCC(C)CC2)cc1 |
| InChI | InChI=1S/C22H26BrN5/c1-15-4-8-19(9-5-15)28-21(25-26-27-28)22(12-10-16(2)11-13-22)24-18-7-6-17(3)20(23)14-18/h4-9,14,16,24H,10-13H2,1-3H3 |
| InChIKey | NDHWYBCJQFOILG-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.39 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |