C21H25N5 — CID 30310073
3,5-dimethyl-N-[1-(1-phenyltetrazol-5-yl)cyclohexyl]aniline (PubChem CID 30310073) has the molecular formula C21H25N5 and a molecular weight of 347.47 g/mol. Its IUPAC name is 3,5-dimethyl-N-[1-(1-phenyltetrazol-5-yl)cyclohexyl]aniline.
| Compound Name | 3,5-dimethyl-N-[1-(1-phenyltetrazol-5-yl)cyclohexyl]aniline |
|---|---|
| PubChem CID | 30310073 |
| Molecular Formula | C21H25N5 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 3,5-dimethyl-N-[1-(1-phenyltetrazol-5-yl)cyclohexyl]aniline |
| SMILES | Cc1cc(C)cc(NC2(c3nnnn3-c3ccccc3)CCCCC2)c1 |
| InChI | InChI=1S/C21H25N5/c1-16-13-17(2)15-18(14-16)22-21(11-7-4-8-12-21)20-23-24-25-26(20)19-9-5-3-6-10-19/h3,5-6,9-10,13-15,22H,4,7-8,11-12H2,1-2H3 |
| InChIKey | AKBLLRBXCBOCTQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |