C20H23N5 — CID 30312000
N-benzyl-1-(1-phenyltetrazol-5-yl)cyclohexan-1-amine (PubChem CID 30312000) has the molecular formula C20H23N5 and a molecular weight of 333.44 g/mol. Its IUPAC name is N-benzyl-1-(1-phenyltetrazol-5-yl)cyclohexan-1-amine.
| Compound Name | N-benzyl-1-(1-phenyltetrazol-5-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 30312000 |
| Molecular Formula | C20H23N5 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | N-benzyl-1-(1-phenyltetrazol-5-yl)cyclohexan-1-amine |
| SMILES | c1ccc(CNC2(c3nnnn3-c3ccccc3)CCCCC2)cc1 |
| InChI | InChI=1S/C20H23N5/c1-4-10-17(11-5-1)16-21-20(14-8-3-9-15-20)19-22-23-24-25(19)18-12-6-2-7-13-18/h1-2,4-7,10-13,21H,3,8-9,14-16H2 |
| InChIKey | WBBPJTMAIVWVQD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |