C23H29N5O — CID 30312378
N-[1-[1-(3,5-dimethylphenyl)tetrazol-5-yl]-4-methylcyclohexyl]-4-methoxyaniline (PubChem CID 30312378) has the molecular formula C23H29N5O and a molecular weight of 391.52 g/mol. Its IUPAC name is N-[1-[1-(3,5-dimethylphenyl)tetrazol-5-yl]-4-methylcyclohexyl]-4-methoxyaniline.
| Compound Name | N-[1-[1-(3,5-dimethylphenyl)tetrazol-5-yl]-4-methylcyclohexyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 30312378 |
| Molecular Formula | C23H29N5O |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | N-[1-[1-(3,5-dimethylphenyl)tetrazol-5-yl]-4-methylcyclohexyl]-4-methoxyaniline |
| SMILES | COc1ccc(NC2(c3nnnn3-c3cc(C)cc(C)c3)CCC(C)CC2)cc1 |
| InChI | InChI=1S/C23H29N5O/c1-16-9-11-23(12-10-16,24-19-5-7-21(29-4)8-6-19)22-25-26-27-28(22)20-14-17(2)13-18(3)15-20/h5-8,13-16,24H,9-12H2,1-4H3 |
| InChIKey | UICYCTDUGQBCSE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|