C22H27N5O — CID 30309876
N-[1-[1-(2,4-dimethylphenyl)tetrazol-5-yl]cyclohexyl]-4-methoxyaniline (PubChem CID 30309876) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is N-[1-[1-(2,4-dimethylphenyl)tetrazol-5-yl]cyclohexyl]-4-methoxyaniline.
| Compound Name | N-[1-[1-(2,4-dimethylphenyl)tetrazol-5-yl]cyclohexyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 30309876 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | N-[1-[1-(2,4-dimethylphenyl)tetrazol-5-yl]cyclohexyl]-4-methoxyaniline |
| SMILES | COc1ccc(NC2(c3nnnn3-c3ccc(C)cc3C)CCCCC2)cc1 |
| InChI | InChI=1S/C22H27N5O/c1-16-7-12-20(17(2)15-16)27-21(24-25-26-27)22(13-5-4-6-14-22)23-18-8-10-19(28-3)11-9-18/h7-12,15,23H,4-6,13-14H2,1-3H3 |
| InChIKey | LAZOHJYVPCKDAL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|