C22H25N5O — CID 30310326
N-[1-[1-(2,4-dimethylphenyl)tetrazol-5-yl]cyclohexyl]benzamide (PubChem CID 30310326) has the molecular formula C22H25N5O and a molecular weight of 375.48 g/mol. Its IUPAC name is N-[1-[1-(2,4-dimethylphenyl)tetrazol-5-yl]cyclohexyl]benzamide.
| Compound Name | N-[1-[1-(2,4-dimethylphenyl)tetrazol-5-yl]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 30310326 |
| Molecular Formula | C22H25N5O |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | N-[1-[1-(2,4-dimethylphenyl)tetrazol-5-yl]cyclohexyl]benzamide |
| SMILES | Cc1ccc(-n2nnnc2C2(NC(=O)c3ccccc3)CCCCC2)c(C)c1 |
| InChI | InChI=1S/C22H25N5O/c1-16-11-12-19(17(2)15-16)27-21(24-25-26-27)22(13-7-4-8-14-22)23-20(28)18-9-5-3-6-10-18/h3,5-6,9-12,15H,4,7-8,13-14H2,1-2H3,(H,23,28) |
| InChIKey | OFVNXOKWJMWGSX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |