C22H27N5O2 — CID 7393898
4-methoxy-N-[(1R,2S)-1-[1-(4-methoxyphenyl)tetrazol-5-yl]-2-methylcyclohexyl]aniline (PubChem CID 7393898) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 4-methoxy-N-[(1R,2S)-1-[1-(4-methoxyphenyl)tetrazol-5-yl]-2-methylcyclohexyl]aniline.
| Compound Name | 4-methoxy-N-[(1R,2S)-1-[1-(4-methoxyphenyl)tetrazol-5-yl]-2-methylcyclohexyl]aniline |
|---|---|
| PubChem CID | 7393898 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 4-methoxy-N-[(1R,2S)-1-[1-(4-methoxyphenyl)tetrazol-5-yl]-2-methylcyclohexyl]aniline |
| SMILES | COc1ccc(N[C@]2(c3nnnn3-c3ccc(OC)cc3)CCCC[C@@H]2C)cc1 |
| InChI | InChI=1S/C22H27N5O2/c1-16-6-4-5-15-22(16,23-17-7-11-19(28-2)12-8-17)21-24-25-26-27(21)18-9-13-20(29-3)14-10-18/h7-14,16,23H,4-6,15H2,1-3H3/t16-,22+/m0/s1 |
| InChIKey | PSSBIKFPMVZAJE-KSFYIVLOSA-N |
| XLogP | 4.20 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|