C22H26ClN5 — CID 30314783
N-[1-[1-(3-chloro-4-methylphenyl)tetrazol-5-yl]-4-methylcyclohexyl]-2-methylaniline (PubChem CID 30314783) has the molecular formula C22H26ClN5 and a molecular weight of 395.94 g/mol. Its IUPAC name is N-[1-[1-(3-chloro-4-methylphenyl)tetrazol-5-yl]-4-methylcyclohexyl]-2-methylaniline.
| Compound Name | N-[1-[1-(3-chloro-4-methylphenyl)tetrazol-5-yl]-4-methylcyclohexyl]-2-methylaniline |
|---|---|
| PubChem CID | 30314783 |
| Molecular Formula | C22H26ClN5 |
| Molecular Weight | 395.94 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | N-[1-[1-(3-chloro-4-methylphenyl)tetrazol-5-yl]-4-methylcyclohexyl]-2-methylaniline |
| SMILES | Cc1ccc(-n2nnnc2C2(Nc3ccccc3C)CCC(C)CC2)cc1Cl |
| InChI | InChI=1S/C22H26ClN5/c1-15-10-12-22(13-11-15,24-20-7-5-4-6-17(20)3)21-25-26-27-28(21)18-9-8-16(2)19(23)14-18/h4-9,14-15,24H,10-13H2,1-3H3 |
| InChIKey | BJRRHSKWAMLZGN-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.94 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |