C23H27N7O2 — CID 135721486
2-[[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclopentyl]amino]-N-[(E)-(4-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 135721486) has the molecular formula C23H27N7O2 and a molecular weight of 433.52 g/mol. Its IUPAC name is 2-[[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclopentyl]amino]-N-[(E)-(4-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclopentyl]amino]-N-[(E)-(4-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135721486 |
| Molecular Formula | C23H27N7O2 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 2-[[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclopentyl]amino]-N-[(E)-(4-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | Cc1cccc(C)c1-n1nnnc1C1(NCC(=O)N/N=C/c2ccc(O)cc2)CCCC1 |
| InChI | InChI=1S/C23H27N7O2/c1-16-6-5-7-17(2)21(16)30-22(27-28-29-30)23(12-3-4-13-23)24-15-20(32)26-25-14-18-8-10-19(31)11-9-18/h5-11,14,24,31H,3-4,12-13,15H2,1-2H3,(H,26,32)/b25-14+ |
| InChIKey | SYJPLUPFETXPDA-AFUMVMLFSA-N |
| XLogP | 2.49 |
| TPSA | 117.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|