C22H24N5O2- — CID 8022850
3-[[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]amino]benzoate (PubChem CID 8022850) has the molecular formula C22H24N5O2- and a molecular weight of 390.47 g/mol. Its IUPAC name is 3-[[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]amino]benzoate.
| Compound Name | 3-[[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]amino]benzoate |
|---|---|
| PubChem CID | 8022850 |
| Molecular Formula | C22H24N5O2- |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 3-[[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]amino]benzoate |
| SMILES | Cc1cccc(C)c1-n1nnnc1C1(Nc2cccc(C(=O)[O-])c2)CCCCC1 |
| InChI | InChI=1S/C22H25N5O2/c1-15-8-6-9-16(2)19(15)27-21(24-25-26-27)22(12-4-3-5-13-22)23-18-11-7-10-17(14-18)20(28)29/h6-11,14,23H,3-5,12-13H2,1-2H3,(H,28,29)/p-1 |
| InChIKey | RZKRPIIIIAWMSB-UHFFFAOYSA-M |
| XLogP | 2.91 |
| TPSA | 95.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |