C23H30N6 — CID 3311481
1-N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]-4-N,4-N-dimethylbenzene-1,4-diamine (PubChem CID 3311481) has the molecular formula C23H30N6 and a molecular weight of 390.54 g/mol. Its IUPAC name is 1-N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]-4-N,4-N-dimethylbenzene-1,4-diamine.
| Compound Name | 1-N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]-4-N,4-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 3311481 |
| Molecular Formula | C23H30N6 |
| Molecular Weight | 390.54 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | 1-N-[1-[1-(2,6-dimethylphenyl)tetrazol-5-yl]cyclohexyl]-4-N,4-N-dimethylbenzene-1,4-diamine |
| SMILES | Cc1cccc(C)c1-n1nnnc1C1(Nc2ccc(N(C)C)cc2)CCCCC1 |
| InChI | InChI=1S/C23H30N6/c1-17-9-8-10-18(2)21(17)29-22(25-26-27-29)23(15-6-5-7-16-23)24-19-11-13-20(14-12-19)28(3)4/h8-14,24H,5-7,15-16H2,1-4H3 |
| InChIKey | OBFGSLIUFPITSV-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|