C21H18N2O5 — CID 30332762
N-[4-[[[2-(2-formylphenoxy)acetyl]amino]methyl]phenyl]furan-2-carboxamide (PubChem CID 30332762) has the molecular formula C21H18N2O5 and a molecular weight of 378.38 g/mol. Its IUPAC name is N-[4-[[[2-(2-formylphenoxy)acetyl]amino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[[2-(2-formylphenoxy)acetyl]amino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 30332762 |
| Molecular Formula | C21H18N2O5 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N-[4-[[[2-(2-formylphenoxy)acetyl]amino]methyl]phenyl]furan-2-carboxamide |
| SMILES | O=Cc1ccccc1OCC(=O)NCc1ccc(NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C21H18N2O5/c24-13-16-4-1-2-5-18(16)28-14-20(25)22-12-15-7-9-17(10-8-15)23-21(26)19-6-3-11-27-19/h1-11,13H,12,14H2,(H,22,25)(H,23,26) |
| InChIKey | FMECABSUGFIEAU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|