C24H27N3O5 — CID 30342538
4-[2-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]ethylamino]chromen-2-one (PubChem CID 30342538) has the molecular formula C24H27N3O5 and a molecular weight of 437.50 g/mol. Its IUPAC name is 4-[2-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]ethylamino]chromen-2-one.
| Compound Name | 4-[2-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]ethylamino]chromen-2-one |
|---|---|
| PubChem CID | 30342538 |
| Molecular Formula | C24H27N3O5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 4-[2-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]ethylamino]chromen-2-one |
| SMILES | COc1cc(OC)cc(C(=O)N2CCN(CCNc3cc(=O)oc4ccccc34)CC2)c1 |
| InChI | InChI=1S/C24H27N3O5/c1-30-18-13-17(14-19(15-18)31-2)24(29)27-11-9-26(10-12-27)8-7-25-21-16-23(28)32-22-6-4-3-5-20(21)22/h3-6,13-16,25H,7-12H2,1-2H3 |
| InChIKey | ROMDZIPVFJIEFK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 84.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|