C25H26N4O4 — CID 39039003
(2S)-2-(1H-indol-3-yl)-2-[4-[2-[(2-oxochromen-4-yl)amino]ethyl]piperazin-1-yl]acetic acid (PubChem CID 39039003) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is (2S)-2-(1H-indol-3-yl)-2-[4-[2-[(2-oxochromen-4-yl)amino]ethyl]piperazin-1-yl]acetic acid.
| Compound Name | (2S)-2-(1H-indol-3-yl)-2-[4-[2-[(2-oxochromen-4-yl)amino]ethyl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 39039003 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | (2S)-2-(1H-indol-3-yl)-2-[4-[2-[(2-oxochromen-4-yl)amino]ethyl]piperazin-1-yl]acetic acid |
| SMILES | O=C(O)[C@H](c1c[nH]c2ccccc12)N1CCN(CCNc2cc(=O)oc3ccccc23)CC1 |
| InChI | InChI=1S/C25H26N4O4/c30-23-15-21(18-6-2-4-8-22(18)33-23)26-9-10-28-11-13-29(14-12-28)24(25(31)32)19-16-27-20-7-3-1-5-17(19)20/h1-8,15-16,24,26-27H,9-14H2,(H,31,32)/t24-/m0/s1 |
| InChIKey | NWHRXLNSMWTXKI-DEOSSOPVSA-N |
| XLogP | 3.13 |
| TPSA | 101.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|