C18H19NO2S — CID 30377596
(E)-N-(2-ethylsulfanylphenyl)-3-(4-methoxyphenyl)prop-2-enamide (PubChem CID 30377596) has the molecular formula C18H19NO2S and a molecular weight of 313.42 g/mol. Its IUPAC name is (E)-N-(2-ethylsulfanylphenyl)-3-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(2-ethylsulfanylphenyl)-3-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 30377596 |
| Molecular Formula | C18H19NO2S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | (E)-N-(2-ethylsulfanylphenyl)-3-(4-methoxyphenyl)prop-2-enamide |
| SMILES | CCSc1ccccc1NC(=O)/C=C/c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H19NO2S/c1-3-22-17-7-5-4-6-16(17)19-18(20)13-10-14-8-11-15(21-2)12-9-14/h4-13H,3H2,1-2H3,(H,19,20)/b13-10+ |
| InChIKey | UDUYNICIWQVKPC-JLHYYAGUSA-N |
| XLogP | 4.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|