About methyl 2-[(4-azidobenzoyl)amino]ethanimidate;hydrochloride
methyl 2-[(4-azidobenzoyl)amino]ethanimidate;hydrochloride (PubChem CID 3037786) has the molecular formula C10H12ClN5O2
and a molecular weight of 269.69 g/mol. Its IUPAC name is methyl 2-[(4-azidobenzoyl)amino]ethanimidate;hydrochloride.
Molecular Properties
| Compound Name | methyl 2-[(4-azidobenzoyl)amino]ethanimidate;hydrochloride |
| PubChem CID | 3037786 |
| Molecular Formula | C10H12ClN5O2 |
| Molecular Weight | 269.69 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | methyl 2-[(4-azidobenzoyl)amino]ethanimidate;hydrochloride |
| SMILES | Cl.[H]/N=C(/CNC(=O)c1ccc(N=[N+]=[N-])cc1)OC |
| InChI | InChI=1S/C10H11N5O2.ClH/c1-17-9(11)6-13-10(16)7-2-4-8(5-3-7)14-15-12;/h2-5,11H,6H2,1H3,(H,13,16);1H/b11-9-; |
| InChIKey | HPJGGJKSFWMQDX-KSIDEHCFSA-N |
| XLogP | 2.40 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.69 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(4-azidobenzoyl)amino]ethanimidate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(4-azidobenzoyl)amino]ethanimidate;hydrochloride?
The IUPAC name of methyl 2-[(4-azidobenzoyl)amino]ethanimidate;hydrochloride (CID 3037786) is methyl 2-[(4-azidobenzoyl)amino]ethanimidate;hydrochloride.
What is the SMILES notation for methyl 2-[(4-azidobenzoyl)amino]ethanimidate;hydrochloride?
The canonical SMILES for methyl 2-[(4-azidobenzoyl)amino]ethanimidate;hydrochloride is Cl.[H]/N=C(/CNC(=O)c1ccc(N=[N+]=[N-])cc1)OC.
What is the InChIKey of methyl 2-[(4-azidobenzoyl)amino]ethanimidate;hydrochloride?
The InChIKey is HPJGGJKSFWMQDX-KSIDEHCFSA-N. The full InChI is InChI=1S/C10H11N5O2.ClH/c1-17-9(11)6-13-10(16)7-2-4-8(5-3-7)14-15-12;/h2-5,11H,6H2,1H3,(H,13,16);1H/b11-9-;.
What are the key properties of methyl 2-[(4-azidobenzoyl)amino]ethanimidate;hydrochloride?
methyl 2-[(4-azidobenzoyl)amino]ethanimidate;hydrochloride has a molecular weight of 269.69 g/mol, XLogP of 2.40, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(4-azidobenzoyl)amino]ethanimidate;hydrochloride is sourced from PubChem (CID 3037786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).