C31H35N7O7 — CID 162038272
4-azido-N-[2-[(2-methoxyacetyl)amino]ethyl]benzamide;4-benzoyl-N-[2-[(2-methoxyacetyl)amino]ethyl]benzamide (PubChem CID 162038272) has the molecular formula C31H35N7O7 and a molecular weight of 617.66 g/mol. Its IUPAC name is 4-azido-N-[2-[(2-methoxyacetyl)amino]ethyl]benzamide;4-benzoyl-N-[2-[(2-methoxyacetyl)amino]ethyl]benzamide.
| Compound Name | 4-azido-N-[2-[(2-methoxyacetyl)amino]ethyl]benzamide;4-benzoyl-N-[2-[(2-methoxyacetyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 162038272 |
| Molecular Formula | C31H35N7O7 |
| Molecular Weight | 617.66 g/mol |
| Exact Mass | 617.26 |
| IUPAC Name | 4-azido-N-[2-[(2-methoxyacetyl)amino]ethyl]benzamide;4-benzoyl-N-[2-[(2-methoxyacetyl)amino]ethyl]benzamide |
| SMILES | COCC(=O)NCCNC(=O)c1ccc(C(=O)c2ccccc2)cc1.COCC(=O)NCCNC(=O)c1ccc(N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C19H20N2O4.C12H15N5O3/c1-25-13-17(22)20-11-12-21-19(24)16-9-7-15(8-10-16)18(23)14-5-3-2-4-6-14;1-20-8-11(18)14-6-7-15-12(19)9-2-4-10(5-3-9)16-17-13/h2-10H,11-13H2,1H3,(H,20,22)(H,21,24);2-5H,6-8H2,1H3,(H,14,18)(H,15,19) |
| InChIKey | YWXYBOWPYGPHSW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 200.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.66 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|