C25H26N2O3 — CID 3038738
N-(2-benzyl-3,4-dihydro-1H-isoquinolin-5-yl)-3,4-dimethoxybenzamide (PubChem CID 3038738) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is N-(2-benzyl-3,4-dihydro-1H-isoquinolin-5-yl)-3,4-dimethoxybenzamide.
| Compound Name | N-(2-benzyl-3,4-dihydro-1H-isoquinolin-5-yl)-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 3038738 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | N-(2-benzyl-3,4-dihydro-1H-isoquinolin-5-yl)-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc3c2CCN(Cc2ccccc2)C3)cc1OC |
| InChI | InChI=1S/C25H26N2O3/c1-29-23-12-11-19(15-24(23)30-2)25(28)26-22-10-6-9-20-17-27(14-13-21(20)22)16-18-7-4-3-5-8-18/h3-12,15H,13-14,16-17H2,1-2H3,(H,26,28) |
| InChIKey | RDZNFFLOJKAAPB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |