C19H21Cl3N2O5S — CID 30387865
N-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide (PubChem CID 30387865) has the molecular formula C19H21Cl3N2O5S and a molecular weight of 495.81 g/mol. Its IUPAC name is N-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 30387865 |
| Molecular Formula | C19H21Cl3N2O5S |
| Molecular Weight | 495.81 g/mol |
| Exact Mass | 494.02 |
| IUPAC Name | N-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]-2-(2,4,5-trichloro-N-methylsulfonylanilino)acetamide |
| SMILES | COc1ccc([C@@H](C)NC(=O)CN(c2cc(Cl)c(Cl)cc2Cl)S(C)(=O)=O)cc1OC |
| InChI | InChI=1S/C19H21Cl3N2O5S/c1-11(12-5-6-17(28-2)18(7-12)29-3)23-19(25)10-24(30(4,26)27)16-9-14(21)13(20)8-15(16)22/h5-9,11H,10H2,1-4H3,(H,23,25)/t11-/m1/s1 |
| InChIKey | FNIIEPTVWXTMJM-LLVKDONJSA-N |
| XLogP | 4.31 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.81 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|