C19H23IN2O5S — CID 99959520
N-[(1S)-1-(3,4-dimethoxyphenyl)ethyl]-2-(4-iodo-N-methylsulfonylanilino)acetamide (PubChem CID 99959520) has the molecular formula C19H23IN2O5S and a molecular weight of 518.37 g/mol. Its IUPAC name is N-[(1S)-1-(3,4-dimethoxyphenyl)ethyl]-2-(4-iodo-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[(1S)-1-(3,4-dimethoxyphenyl)ethyl]-2-(4-iodo-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 99959520 |
| Molecular Formula | C19H23IN2O5S |
| Molecular Weight | 518.37 g/mol |
| Exact Mass | 518.04 |
| IUPAC Name | N-[(1S)-1-(3,4-dimethoxyphenyl)ethyl]-2-(4-iodo-N-methylsulfonylanilino)acetamide |
| SMILES | COc1ccc([C@H](C)NC(=O)CN(c2ccc(I)cc2)S(C)(=O)=O)cc1OC |
| InChI | InChI=1S/C19H23IN2O5S/c1-13(14-5-10-17(26-2)18(11-14)27-3)21-19(23)12-22(28(4,24)25)16-8-6-15(20)7-9-16/h5-11,13H,12H2,1-4H3,(H,21,23)/t13-/m0/s1 |
| InChIKey | UQUSVUFCLSDQSX-ZDUSSCGKSA-N |
| XLogP | 2.95 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|