C24H25IN2O5S — CID 43916981
2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[1-(3,4-dimethoxyphenyl)ethyl]acetamide (PubChem CID 43916981) has the molecular formula C24H25IN2O5S and a molecular weight of 580.44 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[1-(3,4-dimethoxyphenyl)ethyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[1-(3,4-dimethoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 43916981 |
| Molecular Formula | C24H25IN2O5S |
| Molecular Weight | 580.44 g/mol |
| Exact Mass | 580.05 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[1-(3,4-dimethoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc(C(C)NC(=O)CN(c2ccc(I)cc2)S(=O)(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C24H25IN2O5S/c1-17(18-9-14-22(31-2)23(15-18)32-3)26-24(28)16-27(20-12-10-19(25)11-13-20)33(29,30)21-7-5-4-6-8-21/h4-15,17H,16H2,1-3H3,(H,26,28) |
| InChIKey | BHIJWBFKXMADRK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|