C13H21Cl3N2S2 — CID 3038799
3-[5-[(5-chloro-2-pyridinyl)sulfanyl]pentyl]-1,3-thiazolidine;dihydrochloride (PubChem CID 3038799) has the molecular formula C13H21Cl3N2S2 and a molecular weight of 375.82 g/mol. Its IUPAC name is 3-[5-[(5-chloro-2-pyridinyl)sulfanyl]pentyl]-1,3-thiazolidine;dihydrochloride.
| Compound Name | 3-[5-[(5-chloro-2-pyridinyl)sulfanyl]pentyl]-1,3-thiazolidine;dihydrochloride |
|---|---|
| PubChem CID | 3038799 |
| Molecular Formula | C13H21Cl3N2S2 |
| Molecular Weight | 375.82 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 3-[5-[(5-chloro-2-pyridinyl)sulfanyl]pentyl]-1,3-thiazolidine;dihydrochloride |
| SMILES | Cl.Cl.Clc1ccc(SCCCCCN2CCSC2)nc1 |
| InChI | InChI=1S/C13H19ClN2S2.2ClH/c14-12-4-5-13(15-10-12)18-8-3-1-2-6-16-7-9-17-11-16;;/h4-5,10H,1-3,6-9,11H2;2*1H |
| InChIKey | KZKHRXIMQFERJC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.82 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|