C14H21BrN2S2 — CID 3038806
3-[6-[(5-bromo-2-pyridinyl)sulfanyl]hexyl]-1,3-thiazolidine (PubChem CID 3038806) has the molecular formula C14H21BrN2S2 and a molecular weight of 361.37 g/mol. Its IUPAC name is 3-[6-[(5-bromo-2-pyridinyl)sulfanyl]hexyl]-1,3-thiazolidine.
| Compound Name | 3-[6-[(5-bromo-2-pyridinyl)sulfanyl]hexyl]-1,3-thiazolidine |
|---|---|
| PubChem CID | 3038806 |
| Molecular Formula | C14H21BrN2S2 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | 3-[6-[(5-bromo-2-pyridinyl)sulfanyl]hexyl]-1,3-thiazolidine |
| SMILES | Brc1ccc(SCCCCCCN2CCSC2)nc1 |
| InChI | InChI=1S/C14H21BrN2S2/c15-13-5-6-14(16-11-13)19-9-4-2-1-3-7-17-8-10-18-12-17/h5-6,11H,1-4,7-10,12H2 |
| InChIKey | FRXQRPLFODBZJN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|