C20H24ClNO2 — CID 3038979
pyridin-2-ylmethyl 2-cyclohexyl-2-phenylacetate;hydrochloride (PubChem CID 3038979) has the molecular formula C20H24ClNO2 and a molecular weight of 345.87 g/mol. Its IUPAC name is pyridin-2-ylmethyl 2-cyclohexyl-2-phenylacetate;hydrochloride.
| Compound Name | pyridin-2-ylmethyl 2-cyclohexyl-2-phenylacetate;hydrochloride |
|---|---|
| PubChem CID | 3038979 |
| Molecular Formula | C20H24ClNO2 |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | pyridin-2-ylmethyl 2-cyclohexyl-2-phenylacetate;hydrochloride |
| SMILES | Cl.O=C(OCc1ccccn1)C(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C20H23NO2.ClH/c22-20(23-15-18-13-7-8-14-21-18)19(16-9-3-1-4-10-16)17-11-5-2-6-12-17;/h1,3-4,7-10,13-14,17,19H,2,5-6,11-12,15H2;1H |
| InChIKey | HAEZDXKEVUNMQD-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |