C17H23BrN2O4S — CID 30389996
[1-[(4-bromophenyl)methylsulfonyl]piperidin-4-yl]-morpholin-4-ylmethanone (PubChem CID 30389996) has the molecular formula C17H23BrN2O4S and a molecular weight of 431.35 g/mol. Its IUPAC name is [1-[(4-bromophenyl)methylsulfonyl]piperidin-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-[(4-bromophenyl)methylsulfonyl]piperidin-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 30389996 |
| Molecular Formula | C17H23BrN2O4S |
| Molecular Weight | 431.35 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | [1-[(4-bromophenyl)methylsulfonyl]piperidin-4-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(C1CCN(S(=O)(=O)Cc2ccc(Br)cc2)CC1)N1CCOCC1 |
| InChI | InChI=1S/C17H23BrN2O4S/c18-16-3-1-14(2-4-16)13-25(22,23)20-7-5-15(6-8-20)17(21)19-9-11-24-12-10-19/h1-4,15H,5-13H2 |
| InChIKey | JUPQYRTVIVVCPF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |