C19H27BrN2O3S — CID 92673806
[1-[(4-bromophenyl)methylsulfonyl]piperidin-4-yl]-[(3R)-3-methylpiperidin-1-yl]methanone (PubChem CID 92673806) has the molecular formula C19H27BrN2O3S and a molecular weight of 443.41 g/mol. Its IUPAC name is [1-[(4-bromophenyl)methylsulfonyl]piperidin-4-yl]-[(3R)-3-methylpiperidin-1-yl]methanone.
| Compound Name | [1-[(4-bromophenyl)methylsulfonyl]piperidin-4-yl]-[(3R)-3-methylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 92673806 |
| Molecular Formula | C19H27BrN2O3S |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | [1-[(4-bromophenyl)methylsulfonyl]piperidin-4-yl]-[(3R)-3-methylpiperidin-1-yl]methanone |
| SMILES | C[C@@H]1CCCN(C(=O)C2CCN(S(=O)(=O)Cc3ccc(Br)cc3)CC2)C1 |
| InChI | InChI=1S/C19H27BrN2O3S/c1-15-3-2-10-21(13-15)19(23)17-8-11-22(12-9-17)26(24,25)14-16-4-6-18(20)7-5-16/h4-7,15,17H,2-3,8-14H2,1H3/t15-/m1/s1 |
| InChIKey | MIXHTNFSZNDRDM-OAHLLOKOSA-N |
| XLogP | 3.25 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |