C27H24N2O2S — CID 30395138
2-[(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]-N-[[(15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]acetamide (PubChem CID 30395138) has the molecular formula C27H24N2O2S and a molecular weight of 440.57 g/mol. Its IUPAC name is 2-[(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]-N-[[(15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]acetamide.
| Compound Name | 2-[(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]-N-[[(15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]acetamide |
|---|---|
| PubChem CID | 30395138 |
| Molecular Formula | C27H24N2O2S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 2-[(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]-N-[[(15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]acetamide |
| SMILES | O=C(C[C@@H]1Sc2ccccc2NC1=O)NC[C@@H]1CC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C27H24N2O2S/c30-25(14-24-27(31)29-22-11-5-6-12-23(22)32-24)28-15-16-13-21-17-7-1-3-9-19(17)26(16)20-10-4-2-8-18(20)21/h1-12,16,21,24,26H,13-15H2,(H,28,30)(H,29,31)/t16-,21?,24-,26?/m0/s1 |
| InChIKey | NYVQHPFTYZUGRQ-BBPDEKDOSA-N |
| XLogP | 4.90 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |